C17H20N4O5S2 — CID 55411760
2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 55411760) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 55411760 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-[(E)-[amino(thiophen-3-yl)methylidene]amino]oxy-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | N/C(=N/OCC(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccsc1 |
| InChI | InChI=1S/C17H20N4O5S2/c18-17(13-5-10-27-12-13)20-26-11-16(22)19-14-1-3-15(4-2-14)28(23,24)21-6-8-25-9-7-21/h1-5,10,12H,6-9,11H2,(H2,18,20)(H,19,22) |
| InChIKey | RXDSTBSDNCVZOH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|