C28H29N3O7S — CID 4265032
[2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-benzamido-3-phenylpropanoate (PubChem CID 4265032) has the molecular formula C28H29N3O7S and a molecular weight of 551.62 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-benzamido-3-phenylpropanoate.
| Compound Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 4265032 |
| Molecular Formula | C28H29N3O7S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | [2-(4-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
| SMILES | O=C(COC(=O)CC(NC(=O)c1ccccc1)c1ccccc1)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C28H29N3O7S/c32-26(29-23-11-13-24(14-12-23)39(35,36)31-15-17-37-18-16-31)20-38-27(33)19-25(21-7-3-1-4-8-21)30-28(34)22-9-5-2-6-10-22/h1-14,25H,15-20H2,(H,29,32)(H,30,34) |
| InChIKey | YJENFWPAYPGKIG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |