C20H18N4O2 — CID 126805364
N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]isoquinoline-1-carboximidamide (PubChem CID 126805364) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]isoquinoline-1-carboximidamide.
| Compound Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]isoquinoline-1-carboximidamide |
|---|---|
| PubChem CID | 126805364 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]isoquinoline-1-carboximidamide |
| SMILES | NC(=NOCC(=O)N1CCc2ccccc21)c1nccc2ccccc12 |
| InChI | InChI=1S/C20H18N4O2/c21-20(19-16-7-3-1-5-14(16)9-11-22-19)23-26-13-18(25)24-12-10-15-6-2-4-8-17(15)24/h1-9,11H,10,12-13H2,(H2,21,23) |
| InChIKey | UWAIWFMGNJTBEL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|