C15H13N3O3 — CID 2715390
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 2715390) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2715390 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1cnccn1 |
| InChI | InChI=1S/C15H13N3O3/c19-14(10-21-15(20)12-9-16-6-7-17-12)18-8-5-11-3-1-2-4-13(11)18/h1-4,6-7,9H,5,8,10H2 |
| InChIKey | LBQCZIGDWYMQFU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |