C15H13NO4 — CID 2429900
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2429900) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2429900 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1ccco1 |
| InChI | InChI=1S/C15H13NO4/c17-14(10-20-15(18)13-6-3-9-19-13)16-8-7-11-4-1-2-5-12(11)16/h1-6,9H,7-8,10H2 |
| InChIKey | JJSUPBPPBRGYIL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |