C26H24NO4P — CID 23879335
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate (PubChem CID 23879335) has the molecular formula C26H24NO4P and a molecular weight of 445.46 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 23879335 |
| Molecular Formula | C26H24NO4P |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-diphenylphosphorylcyclopropane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(P(=O)(c2ccccc2)c2ccccc2)CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H24NO4P/c28-24(27-18-15-20-9-7-8-14-23(20)27)19-31-25(29)26(16-17-26)32(30,21-10-3-1-4-11-21)22-12-5-2-6-13-22/h1-14H,15-19H2 |
| InChIKey | VWUWJPCUUSVIOO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|