C21H25NO3 — CID 8518410
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8518410) has the molecular formula C21H25NO3 and a molecular weight of 339.43 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8518410 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H25NO3/c23-19(22-6-5-15-3-1-2-4-18(15)22)12-25-21(24)20-16-8-13-7-14(10-16)11-17(20)9-13/h1-4,13-14,16-17,20H,5-12H2 |
| InChIKey | RCYHJLDTCOQQRG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |