C28H26ClNO5 — CID 3451101
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate (PubChem CID 3451101) has the molecular formula C28H26ClNO5 and a molecular weight of 491.97 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 3451101 |
| Molecular Formula | C28H26ClNO5 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(Cl)(C3)C1)C2)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H26ClNO5/c1-15(35-26(34)27-10-16-8-17(11-27)13-28(29,12-16)14-27)25(33)30-18-6-7-21-22(9-18)24(32)20-5-3-2-4-19(20)23(21)31/h2-7,9,15-17H,8,10-14H2,1H3,(H,30,33) |
| InChIKey | FRJSGEMBBRRKNY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|