C19H22ClN5O3 — CID 42896474
[1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-chloroadamantane-1-carboxylate (PubChem CID 42896474) has the molecular formula C19H22ClN5O3 and a molecular weight of 403.87 g/mol. Its IUPAC name is [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 42896474 |
| Molecular Formula | C19H22ClN5O3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [1-oxo-1-(7H-purin-6-ylamino)propan-2-yl] 3-chloroadamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(Cl)(C3)C1)C2)C(=O)Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C19H22ClN5O3/c1-10(16(26)25-15-13-14(22-8-21-13)23-9-24-15)28-17(27)18-3-11-2-12(4-18)6-19(20,5-11)7-18/h8-12H,2-7H2,1H3,(H2,21,22,23,24,25,26) |
| InChIKey | RHHHULLVJSEFIL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|