C25H34N2O4 — CID 55309757
[1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 55309757) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55309757 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [1-[benzyl(methyl)amino]-1-oxopropan-2-yl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CC(OC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N2O4/c1-17(24(30)27(2)16-18-6-4-3-5-7-18)31-23(29)15-26-22(28)14-25-11-19-8-20(12-25)10-21(9-19)13-25/h3-7,17,19-21H,8-16H2,1-2H3,(H,26,28) |
| InChIKey | QAOIZQOYTLVHKE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |