C25H30ClNO — CID 102142367
2-[2-[[(1S,3S,5S,7S)-5-chloro-1-(dimethylamino)-2-adamantyl]methyl]phenyl]phenol (PubChem CID 102142367) has the molecular formula C25H30ClNO and a molecular weight of 395.97 g/mol. Its IUPAC name is 2-[2-[[(1S,3S,5S,7S)-5-chloro-1-(dimethylamino)-2-adamantyl]methyl]phenyl]phenol.
| Compound Name | 2-[2-[[(1S,3S,5S,7S)-5-chloro-1-(dimethylamino)-2-adamantyl]methyl]phenyl]phenol |
|---|---|
| PubChem CID | 102142367 |
| Molecular Formula | C25H30ClNO |
| Molecular Weight | 395.97 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[2-[[(1S,3S,5S,7S)-5-chloro-1-(dimethylamino)-2-adamantyl]methyl]phenyl]phenol |
| SMILES | CN(C)[C@@]12C[C@@H]3C[C@@H](C[C@@](Cl)(C3)C1)C2Cc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/C25H30ClNO/c1-27(2)25-14-17-11-19(15-24(26,13-17)16-25)22(25)12-18-7-3-4-8-20(18)21-9-5-6-10-23(21)28/h3-10,17,19,22,28H,11-16H2,1-2H3/t17-,19+,22?,24+,25+/m1/s1 |
| InChIKey | ZXIMDRFCHSLHAR-GICCIQERSA-N |
| XLogP | 5.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|