C17H19NS — CID 166985131
N-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide (PubChem CID 166985131) has the molecular formula C17H19NS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide.
| Compound Name | N-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
|---|---|
| PubChem CID | 166985131 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carbothioamide |
| SMILES | C=NC(=S)C12CC3CC1CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C17H19NS/c1-18-15(19)17-9-12-7-14(17)10-16(8-12,11-17)13-5-3-2-4-6-13/h2-6,12,14H,1,7-11H2 |
| InChIKey | RWTFXFLQCCIOMR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|