C23H23BrO — CID 11741375
[(1S,3R)-2-bromo-5-phenyl-2-adamantyl]-phenylmethanone (PubChem CID 11741375) has the molecular formula C23H23BrO and a molecular weight of 395.34 g/mol. Its IUPAC name is [(1S,3R)-2-bromo-5-phenyl-2-adamantyl]-phenylmethanone.
| Compound Name | [(1S,3R)-2-bromo-5-phenyl-2-adamantyl]-phenylmethanone |
|---|---|
| PubChem CID | 11741375 |
| Molecular Formula | C23H23BrO |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [(1S,3R)-2-bromo-5-phenyl-2-adamantyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(Br)[C@@H]2CC3C[C@H]1CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H23BrO/c24-23(21(25)17-7-3-1-4-8-17)19-11-16-12-20(23)15-22(13-16,14-19)18-9-5-2-6-10-18/h1-10,16,19-20H,11-15H2/t16?,19-,20+,22?,23? |
| InChIKey | LLBNMQBHMWLABT-DYWACASYSA-N |
| XLogP | 5.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|