C23H25NO2S — CID 10738517
(3S,5R)-4-(nitromethyl)-1-phenyl-4-phenylsulfanyladamantane (PubChem CID 10738517) has the molecular formula C23H25NO2S and a molecular weight of 379.52 g/mol. Its IUPAC name is (3S,5R)-4-(nitromethyl)-1-phenyl-4-phenylsulfanyladamantane.
| Compound Name | (3S,5R)-4-(nitromethyl)-1-phenyl-4-phenylsulfanyladamantane |
|---|---|
| PubChem CID | 10738517 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (3S,5R)-4-(nitromethyl)-1-phenyl-4-phenylsulfanyladamantane |
| SMILES | O=[N+]([O-])CC1(Sc2ccccc2)[C@@H]2CC3C[C@H]1CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C23H25NO2S/c25-24(26)16-23(27-21-9-5-2-6-10-21)19-11-17-12-20(23)15-22(13-17,14-19)18-7-3-1-4-8-18/h1-10,17,19-20H,11-16H2/t17?,19-,20+,22?,23? |
| InChIKey | HLVYZJRFIXMYMY-ORUNUFAVSA-N |
| XLogP | 5.57 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|