C15H20N2 — CID 67017816
1-(4-aminophenyl)tricyclo[3.3.1.03,7]nonan-3-amine (PubChem CID 67017816) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(4-aminophenyl)tricyclo[3.3.1.03,7]nonan-3-amine.
| Compound Name | 1-(4-aminophenyl)tricyclo[3.3.1.03,7]nonan-3-amine |
|---|---|
| PubChem CID | 67017816 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-(4-aminophenyl)tricyclo[3.3.1.03,7]nonan-3-amine |
| SMILES | Nc1ccc(C23CC4CC(C2)C(N)(C4)C3)cc1 |
| InChI | InChI=1S/C15H20N2/c16-13-3-1-11(2-4-13)14-6-10-5-12(8-14)15(17,7-10)9-14/h1-4,10,12H,5-9,16-17H2 |
| InChIKey | IJZVIEBWKZNZPM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|