C22H28N4 — CID 141391645
2-[3-(2,5-diaminophenyl)-1-adamantyl]benzene-1,4-diamine (PubChem CID 141391645) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[3-(2,5-diaminophenyl)-1-adamantyl]benzene-1,4-diamine.
| Compound Name | 2-[3-(2,5-diaminophenyl)-1-adamantyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 141391645 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[3-(2,5-diaminophenyl)-1-adamantyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(C23CC4CC(C2)CC(c2cc(N)ccc2N)(C4)C3)c1 |
| InChI | InChI=1S/C22H28N4/c23-15-1-3-19(25)17(6-15)21-8-13-5-14(9-21)11-22(10-13,12-21)18-7-16(24)2-4-20(18)26/h1-4,6-7,13-14H,5,8-12,23-26H2 |
| InChIKey | CXUKREUVNYORNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|