C45H48N2O2 — CID 67507271
3-[2-amino-4-[9-[3-amino-4-(3-hydroxy-1-adamantyl)phenyl]fluoren-9-yl]phenyl]adamantan-1-ol (PubChem CID 67507271) has the molecular formula C45H48N2O2 and a molecular weight of 648.89 g/mol. Its IUPAC name is 3-[2-amino-4-[9-[3-amino-4-(3-hydroxy-1-adamantyl)phenyl]fluoren-9-yl]phenyl]adamantan-1-ol.
| Compound Name | 3-[2-amino-4-[9-[3-amino-4-(3-hydroxy-1-adamantyl)phenyl]fluoren-9-yl]phenyl]adamantan-1-ol |
|---|---|
| PubChem CID | 67507271 |
| Molecular Formula | C45H48N2O2 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | 3-[2-amino-4-[9-[3-amino-4-(3-hydroxy-1-adamantyl)phenyl]fluoren-9-yl]phenyl]adamantan-1-ol |
| SMILES | Nc1cc(C2(c3ccc(C45CC6CC(CC(O)(C6)C4)C5)c(N)c3)c3ccccc3-c3ccccc32)ccc1C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C45H48N2O2/c46-39-15-31(9-11-37(39)41-17-27-13-28(18-41)22-43(48,21-27)25-41)45(35-7-3-1-5-33(35)34-6-2-4-8-36(34)45)32-10-12-38(40(47)16-32)42-19-29-14-30(20-42)24-44(49,23-29)26-42/h1-12,15-16,27-30,48-49H,13-14,17-26,46-47H2 |
| InChIKey | NUUXOPWPPXIXID-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|