C17H18N2O6 — CID 162393376
3-(2,4-dinitrophenyl)adamantane-1-carboxylic acid (PubChem CID 162393376) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-(2,4-dinitrophenyl)adamantane-1-carboxylic acid.
| Compound Name | 3-(2,4-dinitrophenyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 162393376 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-(2,4-dinitrophenyl)adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12CC3CC(C1)CC(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C17H18N2O6/c20-15(21)17-7-10-3-11(8-17)6-16(5-10,9-17)13-2-1-12(18(22)23)4-14(13)19(24)25/h1-2,4,10-11H,3,5-9H2,(H,20,21) |
| InChIKey | LXYSOYSUTKZNLN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|