C18H21FO3 — CID 2431648
(5S,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylic acid (PubChem CID 2431648) has the molecular formula C18H21FO3 and a molecular weight of 304.36 g/mol. Its IUPAC name is (5S,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylic acid.
| Compound Name | (5S,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 2431648 |
| Molecular Formula | C18H21FO3 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (5S,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylic acid |
| SMILES | COc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)O)(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C18H21FO3/c1-22-13-2-3-14(15(19)5-13)17-6-11-4-12(7-17)9-18(8-11,10-17)16(20)21/h2-3,5,11-12H,4,6-10H2,1H3,(H,20,21)/t11-,12+,17?,18? |
| InChIKey | KJMFEKZUTNZVJC-CCHVVGMOSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |