C27H29FN2O5 — CID 98677276
[2-(2-benzoylhydrazinyl)-2-oxoethyl] (5R,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylate (PubChem CID 98677276) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] (5R,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (5R,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 98677276 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] (5R,7R)-3-(2-fluoro-4-methoxyphenyl)adamantane-1-carboxylate |
| SMILES | COc1ccc(C23C[C@H]4C[C@@H](CC(C(=O)OCC(=O)NNC(=O)c5ccccc5)(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C27H29FN2O5/c1-34-20-7-8-21(22(28)10-20)26-11-17-9-18(12-26)14-27(13-17,16-26)25(33)35-15-23(31)29-30-24(32)19-5-3-2-4-6-19/h2-8,10,17-18H,9,11-16H2,1H3,(H,29,31)(H,30,32)/t17-,18-,26?,27?/m1/s1 |
| InChIKey | DOQIBMLRVHTLQI-HVRNZWLGSA-N |
| XLogP | 3.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|