C21H28O5 — CID 122660852
3-[4-hydroxy-3,5-bis(methoxymethyl)phenyl]adamantane-1-carboxylic acid (PubChem CID 122660852) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-[4-hydroxy-3,5-bis(methoxymethyl)phenyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[4-hydroxy-3,5-bis(methoxymethyl)phenyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 122660852 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 3-[4-hydroxy-3,5-bis(methoxymethyl)phenyl]adamantane-1-carboxylic acid |
| SMILES | COCc1cc(C23CC4CC(CC(C(=O)O)(C4)C2)C3)cc(COC)c1O |
| InChI | InChI=1S/C21H28O5/c1-25-10-15-4-17(5-16(11-26-2)18(15)22)20-6-13-3-14(7-20)9-21(8-13,12-20)19(23)24/h4-5,13-14,22H,3,6-12H2,1-2H3,(H,23,24) |
| InChIKey | DLXQTDDPZXHERT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |