C11H12FNO2 — CID 141281979
1-(2-fluoro-4-methoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 141281979) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 141281979 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(N)=O)CC2)c(F)c1 |
| InChI | InChI=1S/C11H12FNO2/c1-15-7-2-3-8(9(12)6-7)11(4-5-11)10(13)14/h2-3,6H,4-5H2,1H3,(H2,13,14) |
| InChIKey | DNHBBFGTPMEFJU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |