C30H39NO4 — CID 58493896
3-[3-[(4-methoxyphenyl)-methylcarbamoyl]-1-adamantyl]adamantane-1-carboxylic acid (PubChem CID 58493896) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-[3-[(4-methoxyphenyl)-methylcarbamoyl]-1-adamantyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[3-[(4-methoxyphenyl)-methylcarbamoyl]-1-adamantyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 58493896 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 3-[3-[(4-methoxyphenyl)-methylcarbamoyl]-1-adamantyl]adamantane-1-carboxylic acid |
| SMILES | COc1ccc(N(C)C(=O)C23CC4CC(C2)CC(C25CC6CC(CC(C(=O)O)(C6)C2)C5)(C4)C3)cc1 |
| InChI | InChI=1S/C30H39NO4/c1-31(23-3-5-24(35-2)6-4-23)25(32)27-9-19-7-20(10-27)14-29(13-19,17-27)30-15-21-8-22(16-30)12-28(11-21,18-30)26(33)34/h3-6,19-22H,7-18H2,1-2H3,(H,33,34) |
| InChIKey | DKHKGNXZPXBJQR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |