C31H41NO3 — CID 44625662
3-[3-[methyl(2-phenylethyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylic acid (PubChem CID 44625662) has the molecular formula C31H41NO3 and a molecular weight of 475.67 g/mol. Its IUPAC name is 3-[3-[methyl(2-phenylethyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[3-[methyl(2-phenylethyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 44625662 |
| Molecular Formula | C31H41NO3 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 3-[3-[methyl(2-phenylethyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylic acid |
| SMILES | CN(CCc1ccccc1)C(=O)C12CC3CC(C1)CC(C14CC5CC(CC(C(=O)O)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C31H41NO3/c1-32(8-7-21-5-3-2-4-6-21)26(33)28-11-22-9-23(12-28)16-30(15-22,19-28)31-17-24-10-25(18-31)14-29(13-24,20-31)27(34)35/h2-6,22-25H,7-20H2,1H3,(H,34,35) |
| InChIKey | HZBHJCGNWLYCKN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |