C23H31N3O2 — CID 58493845
3-[3-(4H-triazol-5-yl)-1-adamantyl]adamantane-1-carboxylic acid (PubChem CID 58493845) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[3-(4H-triazol-5-yl)-1-adamantyl]adamantane-1-carboxylic acid.
| Compound Name | 3-[3-(4H-triazol-5-yl)-1-adamantyl]adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 58493845 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 3-[3-(4H-triazol-5-yl)-1-adamantyl]adamantane-1-carboxylic acid |
| SMILES | O=C(O)C12CC3CC(C1)CC(C14CC5CC(CC(C6=NN=NC6)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C23H31N3O2/c27-19(28)21-5-16-2-17(6-21)10-23(9-16,13-21)22-7-14-1-15(8-22)4-20(3-14,12-22)18-11-24-26-25-18/h14-17H,1-13H2,(H,27,28) |
| InChIKey | FNNCYNCCMIWOQA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |