C25H38N2O2 — CID 162754693
cyclohexanamine;3,7-dimethyl-7-(nitrosomethyl)-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde (PubChem CID 162754693) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is cyclohexanamine;3,7-dimethyl-7-(nitrosomethyl)-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde.
| Compound Name | cyclohexanamine;3,7-dimethyl-7-(nitrosomethyl)-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde |
|---|---|
| PubChem CID | 162754693 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | cyclohexanamine;3,7-dimethyl-7-(nitrosomethyl)-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde |
| SMILES | CC1(C=O)CC2CC(C)(CN=O)CC(c3ccccc3)(C2)C1.NC1CCCCC1 |
| InChI | InChI=1S/C19H25NO2.C6H13N/c1-17(13-20-22)8-15-9-18(2,14-21)12-19(10-15,11-17)16-6-4-3-5-7-16;7-6-4-2-1-3-5-6/h3-7,14-15H,8-13H2,1-2H3;6H,1-5,7H2 |
| InChIKey | QWMJHLGGONBNLD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|