C19H25ClO — CID 162525473
7-(chloromethyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde (PubChem CID 162525473) has the molecular formula C19H25ClO and a molecular weight of 304.86 g/mol. Its IUPAC name is 7-(chloromethyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde.
| Compound Name | 7-(chloromethyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde |
|---|---|
| PubChem CID | 162525473 |
| Molecular Formula | C19H25ClO |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 7-(chloromethyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbaldehyde |
| SMILES | CC1(C=O)CC2CC(C)(CCl)CC(c3ccccc3)(C2)C1 |
| InChI | InChI=1S/C19H25ClO/c1-17(13-20)8-15-9-18(2,14-21)12-19(10-15,11-17)16-6-4-3-5-7-16/h3-7,14-15H,8-13H2,1-2H3 |
| InChIKey | JJIMDBNQJHLHBU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|