C25H36N2OS — CID 162525387
N-(4-aminocyclohexyl)-5-(methylsulfanylmethyl)-7-phenyladamantane-2-carboxamide (PubChem CID 162525387) has the molecular formula C25H36N2OS and a molecular weight of 412.64 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-(methylsulfanylmethyl)-7-phenyladamantane-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-5-(methylsulfanylmethyl)-7-phenyladamantane-2-carboxamide |
|---|---|
| PubChem CID | 162525387 |
| Molecular Formula | C25H36N2OS |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-(methylsulfanylmethyl)-7-phenyladamantane-2-carboxamide |
| SMILES | CSCC12CC3CC(c4ccccc4)(CC(C1)C3C(=O)NC1CCC(N)CC1)C2 |
| InChI | InChI=1S/C25H36N2OS/c1-29-16-24-11-17-13-25(15-24,19-5-3-2-4-6-19)14-18(12-24)22(17)23(28)27-21-9-7-20(26)8-10-21/h2-6,17-18,20-22H,7-16,26H2,1H3,(H,27,28) |
| InChIKey | RZNMTLZJWPVXOO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |