C19H16N2O3 — CID 137234398
methyl 1-(2-diazoacetyl)-2,2-diphenylcyclopropane-1-carboxylate (PubChem CID 137234398) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 1-(2-diazoacetyl)-2,2-diphenylcyclopropane-1-carboxylate.
| Compound Name | methyl 1-(2-diazoacetyl)-2,2-diphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 137234398 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl 1-(2-diazoacetyl)-2,2-diphenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)C=[N+]=[N-])CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O3/c1-24-17(23)19(16(22)12-21-20)13-18(19,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,13H2,1H3 |
| InChIKey | OESGKZMVNLFAFI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|