C30H32O4 — CID 158233356
methyl 2-cyclohexa-2,5-dien-1-yl-2-phenylacetate;methyl 7-phenylbicyclo[4.1.0]hept-3-ene-7-carboxylate (PubChem CID 158233356) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is methyl 2-cyclohexa-2,5-dien-1-yl-2-phenylacetate;methyl 7-phenylbicyclo[4.1.0]hept-3-ene-7-carboxylate.
| Compound Name | methyl 2-cyclohexa-2,5-dien-1-yl-2-phenylacetate;methyl 7-phenylbicyclo[4.1.0]hept-3-ene-7-carboxylate |
|---|---|
| PubChem CID | 158233356 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methyl 2-cyclohexa-2,5-dien-1-yl-2-phenylacetate;methyl 7-phenylbicyclo[4.1.0]hept-3-ene-7-carboxylate |
| SMILES | COC(=O)C(c1ccccc1)C1C=CCC=C1.COC(=O)C1(c2ccccc2)C2CC=CCC21 |
| InChI | InChI=1S/2C15H16O2/c1-17-14(16)15(11-7-3-2-4-8-11)12-9-5-6-10-13(12)15;1-17-15(16)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-8,12-13H,9-10H2,1H3;2,4-11,13-14H,3H2,1H3 |
| InChIKey | GEQQCFJNPGKOAZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|