C41H46N2O5SSi — CID 70437807
(4-methoxyphenyl)methyl (2S)-2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-tritylsulfanylazetidine-3-carbonyl]azetidine-1-carboxylate (PubChem CID 70437807) has the molecular formula C41H46N2O5SSi and a molecular weight of 706.98 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S)-2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-tritylsulfanylazetidine-3-carbonyl]azetidine-1-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (2S)-2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-tritylsulfanylazetidine-3-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 70437807 |
| Molecular Formula | C41H46N2O5SSi |
| Molecular Weight | 706.98 g/mol |
| Exact Mass | 706.29 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S)-2-[(3S,4R)-1-[tert-butyl(dimethyl)silyl]-2-oxo-4-tritylsulfanylazetidine-3-carbonyl]azetidine-1-carboxylate |
| SMILES | COc1ccc(COC(=O)N2CC[C@H]2C(=O)[C@H]2C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]2SC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H46N2O5SSi/c1-40(2,3)50(5,6)43-37(45)35(36(44)34-26-27-42(34)39(46)48-28-29-22-24-33(47-4)25-23-29)38(43)49-41(30-16-10-7-11-17-30,31-18-12-8-13-19-31)32-20-14-9-15-21-32/h7-25,34-35,38H,26-28H2,1-6H3/t34-,35-,38+/m0/s1 |
| InChIKey | DZQPGTBPEFBEAM-KYUGQUBOSA-N |
| XLogP | 8.49 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.98 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|