C19H28N2O3SSi — CID 19697095
[1-[tert-butyl(dimethyl)silyl]-3-(ethanethioylamino)-4-oxo-3-phenylazetidin-2-yl] acetate (PubChem CID 19697095) has the molecular formula C19H28N2O3SSi and a molecular weight of 392.60 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]-3-(ethanethioylamino)-4-oxo-3-phenylazetidin-2-yl] acetate.
| Compound Name | [1-[tert-butyl(dimethyl)silyl]-3-(ethanethioylamino)-4-oxo-3-phenylazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 19697095 |
| Molecular Formula | C19H28N2O3SSi |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]-3-(ethanethioylamino)-4-oxo-3-phenylazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1N([Si](C)(C)C(C)(C)C)C(=O)C1(NC(C)=S)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O3SSi/c1-13(25)20-19(15-11-9-8-10-12-15)16(23)21(17(19)24-14(2)22)26(6,7)18(3,4)5/h8-12,17H,1-7H3,(H,20,25) |
| InChIKey | DBNGIIFLOZXNJR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|