About [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid
[1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid (PubChem CID 70534673) has the molecular formula C21H39N3O2Si2
and a molecular weight of 421.73 g/mol. Its IUPAC name is [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid |
| PubChem CID | 70534673 |
| Molecular Formula | C21H39N3O2Si2 |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid |
| SMILES | CC1(NC(=O)O)N([Si](C)(C)C(C)(C)C)c2ccccc2N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39N3O2Si2/c1-19(2,3)27(8,9)23-16-14-12-13-15-17(16)24(21(23,7)22-18(25)26)28(10,11)20(4,5)6/h12-15,22H,1-11H3,(H,25,26) |
| InChIKey | UBUBIAOOGJRXNO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid?
The IUPAC name of [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid (CID 70534673) is [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid.
What is the SMILES notation for [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid?
The canonical SMILES for [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid is CC1(NC(=O)O)N([Si](C)(C)C(C)(C)C)c2ccccc2N1[Si](C)(C)C(C)(C)C.
What is the InChIKey of [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid?
The InChIKey is UBUBIAOOGJRXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39N3O2Si2/c1-19(2,3)27(8,9)23-16-14-12-13-15-17(16)24(21(23,7)22-18(25)26)28(10,11)20(4,5)6/h12-15,22H,1-11H3,(H,25,26).
What are the key properties of [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid?
[1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid has a molecular weight of 421.73 g/mol, XLogP of 6.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-bis[tert-butyl(dimethyl)silyl]-2-methylbenzimidazol-2-yl]carbamic acid is sourced from PubChem (CID 70534673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).