C19H28N2O3SSi — CID 173328733
[(2S,3S)-1-tert-butyl-3-dimethylsilyl-4-oxo-3-[(2-phenylethanethioyl)amino]azetidin-2-yl] acetate (PubChem CID 173328733) has the molecular formula C19H28N2O3SSi and a molecular weight of 392.60 g/mol. Its IUPAC name is [(2S,3S)-1-tert-butyl-3-dimethylsilyl-4-oxo-3-[(2-phenylethanethioyl)amino]azetidin-2-yl] acetate.
| Compound Name | [(2S,3S)-1-tert-butyl-3-dimethylsilyl-4-oxo-3-[(2-phenylethanethioyl)amino]azetidin-2-yl] acetate |
|---|---|
| PubChem CID | 173328733 |
| Molecular Formula | C19H28N2O3SSi |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(2S,3S)-1-tert-butyl-3-dimethylsilyl-4-oxo-3-[(2-phenylethanethioyl)amino]azetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1N(C(C)(C)C)C(=O)[C@@]1(NC(=S)Cc1ccccc1)[SiH](C)C |
| InChI | InChI=1S/C19H28N2O3SSi/c1-13(22)24-17-19(26(5)6,16(23)21(17)18(2,3)4)20-15(25)12-14-10-8-7-9-11-14/h7-11,17,26H,12H2,1-6H3,(H,20,25)/t17-,19+/m0/s1 |
| InChIKey | LRNAGRIAQVPPDH-PKOBYXMFSA-N |
| XLogP | 2.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|