C11H22N2O3Si — CID 173396084
[(2S,3S)-3-amino-1-tert-butyl-3-dimethylsilyl-4-oxoazetidin-2-yl] acetate (PubChem CID 173396084) has the molecular formula C11H22N2O3Si and a molecular weight of 258.39 g/mol. Its IUPAC name is [(2S,3S)-3-amino-1-tert-butyl-3-dimethylsilyl-4-oxoazetidin-2-yl] acetate.
| Compound Name | [(2S,3S)-3-amino-1-tert-butyl-3-dimethylsilyl-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 173396084 |
| Molecular Formula | C11H22N2O3Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [(2S,3S)-3-amino-1-tert-butyl-3-dimethylsilyl-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1N(C(C)(C)C)C(=O)[C@@]1(N)[SiH](C)C |
| InChI | InChI=1S/C11H22N2O3Si/c1-7(14)16-9-11(12,17(5)6)8(15)13(9)10(2,3)4/h9,17H,12H2,1-6H3/t9-,11+/m0/s1 |
| InChIKey | RBZWCNDRWWFJAS-GXSJLCMTSA-N |
| XLogP | 0.24 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|