C33H36BrNO3SSi — CID 70512059
3-[(5-bromofuran-2-yl)-hydroxymethyl]-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 70512059) has the molecular formula C33H36BrNO3SSi and a molecular weight of 634.71 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)-hydroxymethyl]-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | 3-[(5-bromofuran-2-yl)-hydroxymethyl]-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 70512059 |
| Molecular Formula | C33H36BrNO3SSi |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)-hydroxymethyl]-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)C(C(O)c2ccc(Br)o2)C1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H36BrNO3SSi/c1-32(2,3)40(4,5)35-30(37)28(29(36)26-21-22-27(34)38-26)31(35)39-33(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-22,28-29,31,36H,1-5H3 |
| InChIKey | UIUGBZJWQLQGCL-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|