C24H23NO2S — CID 67836097
(3R,4R)-3-(1-hydroxyethyl)-4-tritylsulfanylazetidin-2-one (PubChem CID 67836097) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is (3R,4R)-3-(1-hydroxyethyl)-4-tritylsulfanylazetidin-2-one.
| Compound Name | (3R,4R)-3-(1-hydroxyethyl)-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 67836097 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (3R,4R)-3-(1-hydroxyethyl)-4-tritylsulfanylazetidin-2-one |
| SMILES | CC(O)[C@@H]1C(=O)N[C@@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO2S/c1-17(26)21-22(27)25-23(21)28-24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,21,23,26H,1H3,(H,25,27)/t17?,21-,23-/m1/s1 |
| InChIKey | ZWWOGAZJGMVSTC-XQAYDEMESA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|