C27H24Cl3NO4S — CID 139632216
ethyl [2,2,2-trichloro-1-(2-oxo-4-tritylsulfanylazetidin-3-yl)ethyl] carbonate (PubChem CID 139632216) has the molecular formula C27H24Cl3NO4S and a molecular weight of 564.92 g/mol. Its IUPAC name is ethyl [2,2,2-trichloro-1-(2-oxo-4-tritylsulfanylazetidin-3-yl)ethyl] carbonate.
| Compound Name | ethyl [2,2,2-trichloro-1-(2-oxo-4-tritylsulfanylazetidin-3-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 139632216 |
| Molecular Formula | C27H24Cl3NO4S |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | ethyl [2,2,2-trichloro-1-(2-oxo-4-tritylsulfanylazetidin-3-yl)ethyl] carbonate |
| SMILES | CCOC(=O)OC(C1C(=O)NC1SC(c1ccccc1)(c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H24Cl3NO4S/c1-2-34-25(33)35-22(27(28,29)30)21-23(32)31-24(21)36-26(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,21-22,24H,2H2,1H3,(H,31,32) |
| InChIKey | VQWQEOLZBPZORB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|