C11H14Cl3NO4S3 — CID 88659217
1-[(2R,3R)-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate (PubChem CID 88659217) has the molecular formula C11H14Cl3NO4S3 and a molecular weight of 426.80 g/mol. Its IUPAC name is 1-[(2R,3R)-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate.
| Compound Name | 1-[(2R,3R)-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 88659217 |
| Molecular Formula | C11H14Cl3NO4S3 |
| Molecular Weight | 426.80 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | 1-[(2R,3R)-2-ethylsulfanylcarbothioylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
| SMILES | CCSC(=S)S[C@H]1NC(=O)[C@H]1C(C)OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3NO4S3/c1-3-21-10(20)22-8-6(7(16)15-8)5(2)19-9(17)18-4-11(12,13)14/h5-6,8H,3-4H2,1-2H3,(H,15,16)/t5?,6-,8-/m1/s1 |
| InChIKey | BYNCJUAQLFUBLA-KYVYOHOSSA-N |
| XLogP | 3.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|