C14H18Cl3NO6S — CID 90475985
methyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 90475985) has the molecular formula C14H18Cl3NO6S and a molecular weight of 434.73 g/mol. Its IUPAC name is methyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90475985 |
| Molecular Formula | C14H18Cl3NO6S |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | methyl (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[1-(2,2,2-trichloroethoxycarbonyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N2C(=O)[C@@H](C(C)OC(=O)OCC(Cl)(Cl)Cl)[C@H]2SC1(C)C |
| InChI | InChI=1S/C14H18Cl3NO6S/c1-6(24-12(21)23-5-14(15,16)17)7-9(19)18-8(11(20)22-4)13(2,3)25-10(7)18/h6-8,10H,5H2,1-4H3/t6?,7-,8+,10-/m1/s1 |
| InChIKey | OELLBCWUIIYMSD-CXCKYUMJSA-N |
| XLogP | 2.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|