C15H26Cl3NO4SSi — CID 172727404
1-[1-[tert-butyl(methyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate (PubChem CID 172727404) has the molecular formula C15H26Cl3NO4SSi and a molecular weight of 450.89 g/mol. Its IUPAC name is 1-[1-[tert-butyl(methyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate.
| Compound Name | 1-[1-[tert-butyl(methyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 172727404 |
| Molecular Formula | C15H26Cl3NO4SSi |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 1-[1-[tert-butyl(methyl)silyl]-2-ethylsulfanyl-4-oxoazetidin-3-yl]ethyl 2,2,2-trichloroethyl carbonate |
| SMILES | CCSC1C(C(C)OC(=O)OCC(Cl)(Cl)Cl)C(=O)N1[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C15H26Cl3NO4SSi/c1-7-24-12-10(11(20)19(12)25(6)14(3,4)5)9(2)23-13(21)22-8-15(16,17)18/h9-10,12,25H,7-8H2,1-6H3 |
| InChIKey | HIEQJGZXUQDTBH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|