C30H37NO2SSi — CID 173406629
3-(2-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-tritylsulfanylazetidin-2-one (PubChem CID 173406629) has the molecular formula C30H37NO2SSi and a molecular weight of 503.78 g/mol. Its IUPAC name is 3-(2-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-tritylsulfanylazetidin-2-one.
| Compound Name | 3-(2-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173406629 |
| Molecular Formula | C30H37NO2SSi |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3-(2-dimethylsilyloxy-3,3-dimethylbutan-2-yl)-4-tritylsulfanylazetidin-2-one |
| SMILES | C[SiH](C)OC(C)(C1C(=O)NC1SC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H37NO2SSi/c1-28(2,3)29(4,33-35(5)6)25-26(32)31-27(25)34-30(22-16-10-7-11-17-22,23-18-12-8-13-19-23)24-20-14-9-15-21-24/h7-21,25,27,35H,1-6H3,(H,31,32) |
| InChIKey | XSMQKHSUBMJRMB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|