C15H22OSi — CID 173396171
(4,4-dimethyl-3-phenylpent-1-yn-3-yl)oxy-dimethylsilane (PubChem CID 173396171) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is (4,4-dimethyl-3-phenylpent-1-yn-3-yl)oxy-dimethylsilane.
| Compound Name | (4,4-dimethyl-3-phenylpent-1-yn-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 173396171 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (4,4-dimethyl-3-phenylpent-1-yn-3-yl)oxy-dimethylsilane |
| SMILES | C#CC(O[SiH](C)C)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H22OSi/c1-7-15(14(2,3)4,16-17(5)6)13-11-9-8-10-12-13/h1,8-12,17H,2-6H3 |
| InChIKey | DIMPWPSVLMHZGH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|