C30H34O2Si2 — CID 71334516
(2-dimethylsilyloxy-1,1,2,2-tetraphenylethoxy)-dimethylsilane (PubChem CID 71334516) has the molecular formula C30H34O2Si2 and a molecular weight of 482.77 g/mol. Its IUPAC name is (2-dimethylsilyloxy-1,1,2,2-tetraphenylethoxy)-dimethylsilane.
| Compound Name | (2-dimethylsilyloxy-1,1,2,2-tetraphenylethoxy)-dimethylsilane |
|---|---|
| PubChem CID | 71334516 |
| Molecular Formula | C30H34O2Si2 |
| Molecular Weight | 482.77 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (2-dimethylsilyloxy-1,1,2,2-tetraphenylethoxy)-dimethylsilane |
| SMILES | C[SiH](C)OC(c1ccccc1)(c1ccccc1)C(O[SiH](C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O2Si2/c1-33(2)31-29(25-17-9-5-10-18-25,26-19-11-6-12-20-26)30(32-34(3)4,27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,33-34H,1-4H3 |
| InChIKey | RRBLYCHBNUZCIO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.77 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|