C36H36O3Si — CID 154404319
diethoxy(1,1,2,2,2-pentakis-phenylethoxy)silane (PubChem CID 154404319) has the molecular formula C36H36O3Si and a molecular weight of 544.77 g/mol. Its IUPAC name is diethoxy(1,1,2,2,2-pentakis-phenylethoxy)silane.
| Compound Name | diethoxy(1,1,2,2,2-pentakis-phenylethoxy)silane |
|---|---|
| PubChem CID | 154404319 |
| Molecular Formula | C36H36O3Si |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | diethoxy(1,1,2,2,2-pentakis-phenylethoxy)silane |
| SMILES | CCO[SiH](OCC)OC(c1ccccc1)(c1ccccc1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H36O3Si/c1-3-37-40(38-4-2)39-36(33-26-16-8-17-27-33,34-28-18-9-19-29-34)35(30-20-10-5-11-21-30,31-22-12-6-13-23-31)32-24-14-7-15-25-32/h5-29,40H,3-4H2,1-2H3 |
| InChIKey | MROSPOZOSVKKSJ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|