C19H21BrSi — CID 173045401
(3-bromo-4,4-dimethylpent-1-yn-3-yl)-diphenylsilane (PubChem CID 173045401) has the molecular formula C19H21BrSi and a molecular weight of 357.37 g/mol. Its IUPAC name is (3-bromo-4,4-dimethylpent-1-yn-3-yl)-diphenylsilane.
| Compound Name | (3-bromo-4,4-dimethylpent-1-yn-3-yl)-diphenylsilane |
|---|---|
| PubChem CID | 173045401 |
| Molecular Formula | C19H21BrSi |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (3-bromo-4,4-dimethylpent-1-yn-3-yl)-diphenylsilane |
| SMILES | C#CC(Br)([SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H21BrSi/c1-5-19(20,18(2,3)4)21(16-12-8-6-9-13-16)17-14-10-7-11-15-17/h1,6-15,21H,2-4H3 |
| InChIKey | GVRWHZNBNDNGQA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|