About buta-1,3-diynyl(diphenyl)silane
buta-1,3-diynyl(diphenyl)silane (PubChem CID 102404030) has the molecular formula C16H12Si
and a molecular weight of 232.36 g/mol. Its IUPAC name is buta-1,3-diynyl(diphenyl)silane.
Molecular Properties
| Compound Name | buta-1,3-diynyl(diphenyl)silane |
| PubChem CID | 102404030 |
| Molecular Formula | C16H12Si |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | buta-1,3-diynyl(diphenyl)silane |
| SMILES | C#CC#C[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12Si/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4-13,17H |
| InChIKey | PBUIYCPFVMLTEN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diynyl(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diynyl(diphenyl)silane?
The IUPAC name of buta-1,3-diynyl(diphenyl)silane (CID 102404030) is buta-1,3-diynyl(diphenyl)silane.
What is the SMILES notation for buta-1,3-diynyl(diphenyl)silane?
The canonical SMILES for buta-1,3-diynyl(diphenyl)silane is C#CC#C[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of buta-1,3-diynyl(diphenyl)silane?
The InChIKey is PBUIYCPFVMLTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Si/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4-13,17H.
What are the key properties of buta-1,3-diynyl(diphenyl)silane?
buta-1,3-diynyl(diphenyl)silane has a molecular weight of 232.36 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diynyl(diphenyl)silane is sourced from PubChem (CID 102404030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).