C28H37NO2S2Si — CID 173387732
(3S,4S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(2-phenyl-2-sulfanylideneethyl)-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-2-one (PubChem CID 173387732) has the molecular formula C28H37NO2S2Si and a molecular weight of 511.83 g/mol. Its IUPAC name is (3S,4S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(2-phenyl-2-sulfanylideneethyl)-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(2-phenyl-2-sulfanylideneethyl)-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 173387732 |
| Molecular Formula | C28H37NO2S2Si |
| Molecular Weight | 511.83 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (3S,4S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(2-phenyl-2-sulfanylideneethyl)-4-[(2R)-1-phenyl-1-sulfanylidenepropan-2-yl]azetidin-2-one |
| SMILES | C[C@@H](C(=S)c1ccccc1)[C@@H]1[C@@H]([C@@](C)(O[SiH](C)C)C(C)(C)C)C(=O)N1CC(=S)c1ccccc1 |
| InChI | InChI=1S/C28H37NO2S2Si/c1-19(25(33)21-16-12-9-13-17-21)24-23(28(5,27(2,3)4)31-34(6)7)26(30)29(24)18-22(32)20-14-10-8-11-15-20/h8-17,19,23-24,34H,18H2,1-7H3/t19-,23-,24-,28-/m1/s1 |
| InChIKey | ONTBGUWHIXSFST-TYYKAFGVSA-N |
| XLogP | 6.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.83 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|