C27H45NO9SSi — CID 173309828
diethyl 2-[4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(1-hydroxy-2-oxo-2-prop-2-enoxyethyl)-4-oxoazetidin-2-yl]-2-sulfanylidenebutyl]propanedioate (PubChem CID 173309828) has the molecular formula C27H45NO9SSi and a molecular weight of 587.81 g/mol. Its IUPAC name is diethyl 2-[4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(1-hydroxy-2-oxo-2-prop-2-enoxyethyl)-4-oxoazetidin-2-yl]-2-sulfanylidenebutyl]propanedioate.
| Compound Name | diethyl 2-[4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(1-hydroxy-2-oxo-2-prop-2-enoxyethyl)-4-oxoazetidin-2-yl]-2-sulfanylidenebutyl]propanedioate |
|---|---|
| PubChem CID | 173309828 |
| Molecular Formula | C27H45NO9SSi |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | diethyl 2-[4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-1-(1-hydroxy-2-oxo-2-prop-2-enoxyethyl)-4-oxoazetidin-2-yl]-2-sulfanylidenebutyl]propanedioate |
| SMILES | C=CCOC(=O)C(O)N1C(=O)[C@H]([C@@](C)(O[SiH](C)C)C(C)(C)C)[C@@H]1CCC(=S)CC(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H45NO9SSi/c1-10-15-36-25(33)22(30)28-19(20(21(28)29)27(7,26(4,5)6)37-39(8)9)14-13-17(38)16-18(23(31)34-11-2)24(32)35-12-3/h10,18-20,22,30,39H,1,11-16H2,2-9H3/t19-,20+,22?,27+/m0/s1 |
| InChIKey | GOMIMJZTVDRUIO-VZHJZWKISA-N |
| XLogP | 2.95 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|