C18H28ClN3O5Si — CID 173397078
prop-2-enyl (4R)-4-chloro-2-diazo-4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate (PubChem CID 173397078) has the molecular formula C18H28ClN3O5Si and a molecular weight of 429.98 g/mol. Its IUPAC name is prop-2-enyl (4R)-4-chloro-2-diazo-4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate.
| Compound Name | prop-2-enyl (4R)-4-chloro-2-diazo-4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 173397078 |
| Molecular Formula | C18H28ClN3O5Si |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | prop-2-enyl (4R)-4-chloro-2-diazo-4-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
| SMILES | C=CCOC(=O)C(=[N+]=[N-])C(=O)[C@H](Cl)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C18H28ClN3O5Si/c1-8-9-26-16(25)13(22-20)14(23)11(19)12-10(15(24)21-12)18(5,17(2,3)4)27-28(6)7/h8,10-12,28H,1,9H2,2-7H3,(H,21,24)/t10-,11-,12+,18-/m1/s1 |
| InChIKey | WBHKUCGNRIHLNW-FEIHFNIMSA-N |
| XLogP | 1.48 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|